C13H15N3O — CID 168978283
6-(3-methylpyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one (PubChem CID 168978283) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 6-(3-methylpyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-(3-methylpyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 168978283 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 6-(3-methylpyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one |
| SMILES | CC1CCN(c2cnc3[nH]c(=O)ccc3c2)C1 |
| InChI | InChI=1S/C13H15N3O/c1-9-4-5-16(8-9)11-6-10-2-3-12(17)15-13(10)14-7-11/h2-3,6-7,9H,4-5,8H2,1H3,(H,14,15,17) |
| InChIKey | QJEJGAJMZQACCA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |