C11H18FN3O — CID 144625422
ethane;1-(5-fluoro-4-methylpyrimidin-2-yl)pyrrolidin-3-ol (PubChem CID 144625422) has the molecular formula C11H18FN3O and a molecular weight of 227.28 g/mol. Its IUPAC name is ethane;1-(5-fluoro-4-methylpyrimidin-2-yl)pyrrolidin-3-ol.
| Compound Name | ethane;1-(5-fluoro-4-methylpyrimidin-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 144625422 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | ethane;1-(5-fluoro-4-methylpyrimidin-2-yl)pyrrolidin-3-ol |
| SMILES | CC.Cc1nc(N2CCC(O)C2)ncc1F |
| InChI | InChI=1S/C9H12FN3O.C2H6/c1-6-8(10)4-11-9(12-6)13-3-2-7(14)5-13;1-2/h4,7,14H,2-3,5H2,1H3;1-2H3 |
| InChIKey | MVNFWYCNALXSPT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |