C11H14ClNOS — CID 102786621
[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 102786621) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 102786621 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CC1CCN(C(=O)c2cccs2)C1CCl |
| InChI | InChI=1S/C11H14ClNOS/c1-8-4-5-13(9(8)7-12)11(14)10-3-2-6-15-10/h2-3,6,8-9H,4-5,7H2,1H3 |
| InChIKey | VYQFFAJUOHLZHK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|