C7H6N4O2S — CID 102790092
5-(3-aminothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790092) has the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. Its IUPAC name is 5-(3-aminothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-(3-aminothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790092 |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-(3-aminothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc(-c2sccc2N)n1 |
| InChI | InChI=1S/C7H6N4O2S/c8-3-1-2-14-4(3)7-10-6(5(9)12)11-13-7/h1-2H,8H2,(H2,9,12) |
| InChIKey | QHBMUEQISYWYJZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |