C8H4N4O2S — CID 106527841
5-(3-cyanothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 106527841) has the molecular formula C8H4N4O2S and a molecular weight of 220.21 g/mol. Its IUPAC name is 5-(3-cyanothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-(3-cyanothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 106527841 |
| Molecular Formula | C8H4N4O2S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 5-(3-cyanothiophen-2-yl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | N#Cc1ccsc1-c1nc(C(N)=O)no1 |
| InChI | InChI=1S/C8H4N4O2S/c9-3-4-1-2-15-5(4)8-11-7(6(10)13)12-14-8/h1-2H,(H2,10,13) |
| InChIKey | FJDOMGKOPZZWTP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |