C11H10N4O2 — CID 102790172
5-(2,3-dihydro-1H-indol-6-yl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790172) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-indol-6-yl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-(2,3-dihydro-1H-indol-6-yl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790172 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(2,3-dihydro-1H-indol-6-yl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc(-c2ccc3c(c2)NCC3)n1 |
| InChI | InChI=1S/C11H10N4O2/c12-9(16)10-14-11(17-15-10)7-2-1-6-3-4-13-8(6)5-7/h1-2,5,13H,3-4H2,(H2,12,16) |
| InChIKey | SDNIUQKVTPECLD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |