C7H10N4O3 — CID 102790953
5-(aminooxymethyl)-N-cyclopropyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790953) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 5-(aminooxymethyl)-N-cyclopropyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-(aminooxymethyl)-N-cyclopropyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790953 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5-(aminooxymethyl)-N-cyclopropyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NOCc1nc(C(=O)NC2CC2)no1 |
| InChI | InChI=1S/C7H10N4O3/c8-13-3-5-10-6(11-14-5)7(12)9-4-1-2-4/h4H,1-3,8H2,(H,9,12) |
| InChIKey | DDAYHGPAGZGJKC-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|