C16H21N5 — CID 102792335
3-cyclohexyl-8-pyridin-3-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102792335) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-cyclohexyl-8-pyridin-3-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-cyclohexyl-8-pyridin-3-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102792335 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-cyclohexyl-8-pyridin-3-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | c1cncc(C2NCCn3c(C4CCCCC4)nnc32)c1 |
| InChI | InChI=1S/C16H21N5/c1-2-5-12(6-3-1)15-19-20-16-14(18-9-10-21(15)16)13-7-4-8-17-11-13/h4,7-8,11-12,14,18H,1-3,5-6,9-10H2 |
| InChIKey | MCUVBQSXJMNMBE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |