C10H13F5N4 — CID 102792563
3-(1,1,2,2,2-pentafluoroethyl)-8-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102792563) has the molecular formula C10H13F5N4 and a molecular weight of 284.23 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-8-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-8-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102792563 |
| Molecular Formula | C10H13F5N4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-8-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCC1NCCn2c1nnc2C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5N4/c1-2-3-6-7-17-18-8(19(7)5-4-16-6)9(11,12)10(13,14)15/h6,16H,2-5H2,1H3 |
| InChIKey | RYGUQKWPJOLNAD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|