C11H19N5S — CID 102793725
6-[5-(methylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102793725) has the molecular formula C11H19N5S and a molecular weight of 253.37 g/mol. Its IUPAC name is 6-[5-(methylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-[5-(methylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102793725 |
| Molecular Formula | C11H19N5S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-[5-(methylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CSCc1nc(N2CC3CCCNC3C2)n[nH]1 |
| InChI | InChI=1S/C11H19N5S/c1-17-7-10-13-11(15-14-10)16-5-8-3-2-4-12-9(8)6-16/h8-9,12H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | OTZNFAAJBDQIME-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |