C13H16IN5S — CID 102793699
6-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102793699) has the molecular formula C13H16IN5S and a molecular weight of 401.28 g/mol. Its IUPAC name is 6-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102793699 |
| Molecular Formula | C13H16IN5S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 6-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Ic1cc(-c2nc(N3CC4CCCNC4C3)n[nH]2)cs1 |
| InChI | InChI=1S/C13H16IN5S/c14-11-4-9(7-20-11)12-16-13(18-17-12)19-5-8-2-1-3-15-10(8)6-19/h4,7-8,10,15H,1-3,5-6H2,(H,16,17,18) |
| InChIKey | SNIKLRXOYSQYTM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|