C12H16IN5S — CID 102800470
1-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-N-methylpiperidin-4-amine (PubChem CID 102800470) has the molecular formula C12H16IN5S and a molecular weight of 389.27 g/mol. Its IUPAC name is 1-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-N-methylpiperidin-4-amine.
| Compound Name | 1-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 102800470 |
| Molecular Formula | C12H16IN5S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-[5-(5-iodothiophen-3-yl)-1H-1,2,4-triazol-3-yl]-N-methylpiperidin-4-amine |
| SMILES | CNC1CCN(c2n[nH]c(-c3csc(I)c3)n2)CC1 |
| InChI | InChI=1S/C12H16IN5S/c1-14-9-2-4-18(5-3-9)12-15-11(16-17-12)8-6-10(13)19-7-8/h6-7,9,14H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | YTQKZNZPBMCFRP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|