C11H19N5O — CID 102794159
1-[5-(oxolan-2-yl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine (PubChem CID 102794159) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 1-[5-(oxolan-2-yl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine.
| Compound Name | 1-[5-(oxolan-2-yl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 102794159 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1-[5-(oxolan-2-yl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
| SMILES | NC1CCCN(c2n[nH]c(C3CCCO3)n2)C1 |
| InChI | InChI=1S/C11H19N5O/c12-8-3-1-5-16(7-8)11-13-10(14-15-11)9-4-2-6-17-9/h8-9H,1-7,12H2,(H,13,14,15) |
| InChIKey | HCJMFCQFQBHNGI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |