C9H17N5O — CID 102794422
1-[3-(3-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]ethanol (PubChem CID 102794422) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-[3-(3-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]ethanol.
| Compound Name | 1-[3-(3-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]ethanol |
|---|---|
| PubChem CID | 102794422 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[3-(3-aminopiperidin-1-yl)-1H-1,2,4-triazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(N2CCCC(N)C2)n[nH]1 |
| InChI | InChI=1S/C9H17N5O/c1-6(15)8-11-9(13-12-8)14-4-2-3-7(10)5-14/h6-7,15H,2-5,10H2,1H3,(H,11,12,13) |
| InChIKey | BAGDSLUSXOSBAU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |