C15H21N5 — CID 102794281
1-[5-(2-ethylphenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine (PubChem CID 102794281) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 1-[5-(2-ethylphenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine.
| Compound Name | 1-[5-(2-ethylphenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 102794281 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-[5-(2-ethylphenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
| SMILES | CCc1ccccc1-c1nc(N2CCCC(N)C2)n[nH]1 |
| InChI | InChI=1S/C15H21N5/c1-2-11-6-3-4-8-13(11)14-17-15(19-18-14)20-9-5-7-12(16)10-20/h3-4,6,8,12H,2,5,7,9-10,16H2,1H3,(H,17,18,19) |
| InChIKey | RTFBHZYUHMQMHC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |