C13H15Cl2N5 — CID 102794246
1-[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine (PubChem CID 102794246) has the molecular formula C13H15Cl2N5 and a molecular weight of 312.20 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine.
| Compound Name | 1-[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 102794246 |
| Molecular Formula | C13H15Cl2N5 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
| SMILES | NC1CCCN(c2n[nH]c(-c3cc(Cl)ccc3Cl)n2)C1 |
| InChI | InChI=1S/C13H15Cl2N5/c14-8-3-4-11(15)10(6-8)12-17-13(19-18-12)20-5-1-2-9(16)7-20/h3-4,6,9H,1-2,5,7,16H2,(H,17,18,19) |
| InChIKey | KUSYQHNSIDESNM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |