C10H12F3NO4S3 — CID 102794794
methyl 4-methyl-3-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]thiophene-2-carboxylate (PubChem CID 102794794) has the molecular formula C10H12F3NO4S3 and a molecular weight of 363.40 g/mol. Its IUPAC name is methyl 4-methyl-3-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102794794 |
| Molecular Formula | C10H12F3NO4S3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | methyl 4-methyl-3-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4S3/c1-6-5-19-7(9(15)18-2)8(6)21(16,17)14-3-4-20-10(11,12)13/h5,14H,3-4H2,1-2H3 |
| InChIKey | IFXGSHVGSKKHLV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|