C11H10ClN5 — CID 102795584
5-amino-1-(3-chlorophenyl)-3-(methylamino)pyrazole-4-carbonitrile (PubChem CID 102795584) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-amino-1-(3-chlorophenyl)-3-(methylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(3-chlorophenyl)-3-(methylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795584 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-amino-1-(3-chlorophenyl)-3-(methylamino)pyrazole-4-carbonitrile |
| SMILES | CNc1nn(-c2cccc(Cl)c2)c(N)c1C#N |
| InChI | InChI=1S/C11H10ClN5/c1-15-11-9(6-13)10(14)17(16-11)8-4-2-3-7(12)5-8/h2-5H,14H2,1H3,(H,15,16) |
| InChIKey | MUKUWZOBWRLAQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |