C14H12N6 — CID 102795914
5-amino-1-(3-cyanophenyl)-3-(cyclopropylamino)pyrazole-4-carbonitrile (PubChem CID 102795914) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-amino-1-(3-cyanophenyl)-3-(cyclopropylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(3-cyanophenyl)-3-(cyclopropylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795914 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-amino-1-(3-cyanophenyl)-3-(cyclopropylamino)pyrazole-4-carbonitrile |
| SMILES | N#Cc1cccc(-n2nc(NC3CC3)c(C#N)c2N)c1 |
| InChI | InChI=1S/C14H12N6/c15-7-9-2-1-3-11(6-9)20-13(17)12(8-16)14(19-20)18-10-4-5-10/h1-3,6,10H,4-5,17H2,(H,18,19) |
| InChIKey | ZOVMEZOFTYPZKI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |