C14H14BrN5 — CID 102795874
5-amino-1-(3-bromophenyl)-3-(cyclopropylmethylamino)pyrazole-4-carbonitrile (PubChem CID 102795874) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is 5-amino-1-(3-bromophenyl)-3-(cyclopropylmethylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(3-bromophenyl)-3-(cyclopropylmethylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795874 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-amino-1-(3-bromophenyl)-3-(cyclopropylmethylamino)pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(NCC2CC2)nn(-c2cccc(Br)c2)c1N |
| InChI | InChI=1S/C14H14BrN5/c15-10-2-1-3-11(6-10)20-13(17)12(7-16)14(19-20)18-8-9-4-5-9/h1-3,6,9H,4-5,8,17H2,(H,18,19) |
| InChIKey | BBSJVTFLZWZYJV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |