C13H14BrN5 — CID 102796849
5-amino-1-(4-bromo-2-methylphenyl)-3-(ethylamino)pyrazole-4-carbonitrile (PubChem CID 102796849) has the molecular formula C13H14BrN5 and a molecular weight of 320.19 g/mol. Its IUPAC name is 5-amino-1-(4-bromo-2-methylphenyl)-3-(ethylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(4-bromo-2-methylphenyl)-3-(ethylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796849 |
| Molecular Formula | C13H14BrN5 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 5-amino-1-(4-bromo-2-methylphenyl)-3-(ethylamino)pyrazole-4-carbonitrile |
| SMILES | CCNc1nn(-c2ccc(Br)cc2C)c(N)c1C#N |
| InChI | InChI=1S/C13H14BrN5/c1-3-17-13-10(7-15)12(16)19(18-13)11-5-4-9(14)6-8(11)2/h4-6H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | LDPRFRGECRSMJK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |