C10H8FN5 — CID 102826149
3,5-diamino-1-(3-fluorophenyl)pyrazole-4-carbonitrile (PubChem CID 102826149) has the molecular formula C10H8FN5 and a molecular weight of 217.21 g/mol. Its IUPAC name is 3,5-diamino-1-(3-fluorophenyl)pyrazole-4-carbonitrile.
| Compound Name | 3,5-diamino-1-(3-fluorophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102826149 |
| Molecular Formula | C10H8FN5 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3,5-diamino-1-(3-fluorophenyl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nn(-c2cccc(F)c2)c1N |
| InChI | InChI=1S/C10H8FN5/c11-6-2-1-3-7(4-6)16-10(14)8(5-12)9(13)15-16/h1-4H,14H2,(H2,13,15) |
| InChIKey | WYFLDHLNRTUJOO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |