C11H8N6 — CID 102825781
3,5-diamino-1-(4-cyanophenyl)pyrazole-4-carbonitrile (PubChem CID 102825781) has the molecular formula C11H8N6 and a molecular weight of 224.23 g/mol. Its IUPAC name is 3,5-diamino-1-(4-cyanophenyl)pyrazole-4-carbonitrile.
| Compound Name | 3,5-diamino-1-(4-cyanophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102825781 |
| Molecular Formula | C11H8N6 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3,5-diamino-1-(4-cyanophenyl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1ccc(-n2nc(N)c(C#N)c2N)cc1 |
| InChI | InChI=1S/C11H8N6/c12-5-7-1-3-8(4-2-7)17-11(15)9(6-13)10(14)16-17/h1-4H,15H2,(H2,14,16) |
| InChIKey | QVOAOOCSYLHMTE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |