C13H21N5 — CID 102796104
5-amino-1-cycloheptyl-3-(ethylamino)pyrazole-4-carbonitrile (PubChem CID 102796104) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 5-amino-1-cycloheptyl-3-(ethylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-cycloheptyl-3-(ethylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796104 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 5-amino-1-cycloheptyl-3-(ethylamino)pyrazole-4-carbonitrile |
| SMILES | CCNc1nn(C2CCCCCC2)c(N)c1C#N |
| InChI | InChI=1S/C13H21N5/c1-2-16-13-11(9-14)12(15)18(17-13)10-7-5-3-4-6-8-10/h10H,2-8,15H2,1H3,(H,16,17) |
| InChIKey | SDRHAJMDSYGAAM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |