C12H25N5 — CID 91137734
1-cyclohexyl-5-N-ethyl-1,2,4-triazole-3,5-diamine;ethane (PubChem CID 91137734) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is 1-cyclohexyl-5-N-ethyl-1,2,4-triazole-3,5-diamine;ethane.
| Compound Name | 1-cyclohexyl-5-N-ethyl-1,2,4-triazole-3,5-diamine;ethane |
|---|---|
| PubChem CID | 91137734 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | 1-cyclohexyl-5-N-ethyl-1,2,4-triazole-3,5-diamine;ethane |
| SMILES | CC.CCNc1nc(N)nn1C1CCCCC1 |
| InChI | InChI=1S/C10H19N5.C2H6/c1-2-12-10-13-9(11)14-15(10)8-6-4-3-5-7-8;1-2/h8H,2-7H2,1H3,(H3,11,12,13,14);1-2H3 |
| InChIKey | CNPPMLJIIJOYHB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |