C13H12F3N5 — CID 102796740
5-amino-3-(propan-2-ylamino)-1-(3,4,5-trifluorophenyl)pyrazole-4-carbonitrile (PubChem CID 102796740) has the molecular formula C13H12F3N5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 5-amino-3-(propan-2-ylamino)-1-(3,4,5-trifluorophenyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(propan-2-ylamino)-1-(3,4,5-trifluorophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796740 |
| Molecular Formula | C13H12F3N5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-amino-3-(propan-2-ylamino)-1-(3,4,5-trifluorophenyl)pyrazole-4-carbonitrile |
| SMILES | CC(C)Nc1nn(-c2cc(F)c(F)c(F)c2)c(N)c1C#N |
| InChI | InChI=1S/C13H12F3N5/c1-6(2)19-13-8(5-17)12(18)21(20-13)7-3-9(14)11(16)10(15)4-7/h3-4,6H,18H2,1-2H3,(H,19,20) |
| InChIKey | PZMJXDLFKHOFRY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|