C15H27N5 — CID 102797265
1-(5-cycloheptyl-1H-1,2,4-triazol-3-yl)-3,5-dimethylpiperazine (PubChem CID 102797265) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-(5-cycloheptyl-1H-1,2,4-triazol-3-yl)-3,5-dimethylpiperazine.
| Compound Name | 1-(5-cycloheptyl-1H-1,2,4-triazol-3-yl)-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 102797265 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-(5-cycloheptyl-1H-1,2,4-triazol-3-yl)-3,5-dimethylpiperazine |
| SMILES | CC1CN(c2n[nH]c(C3CCCCCC3)n2)CC(C)N1 |
| InChI | InChI=1S/C15H27N5/c1-11-9-20(10-12(2)16-11)15-17-14(18-19-15)13-7-5-3-4-6-8-13/h11-13,16H,3-10H2,1-2H3,(H,17,18,19) |
| InChIKey | RPVLCJITGCVCHV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |