C13H23N5S — CID 102797418
3,5-dimethyl-1-[5-(thian-2-yl)-1H-1,2,4-triazol-3-yl]piperazine (PubChem CID 102797418) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 3,5-dimethyl-1-[5-(thian-2-yl)-1H-1,2,4-triazol-3-yl]piperazine.
| Compound Name | 3,5-dimethyl-1-[5-(thian-2-yl)-1H-1,2,4-triazol-3-yl]piperazine |
|---|---|
| PubChem CID | 102797418 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3,5-dimethyl-1-[5-(thian-2-yl)-1H-1,2,4-triazol-3-yl]piperazine |
| SMILES | CC1CN(c2n[nH]c(C3CCCCS3)n2)CC(C)N1 |
| InChI | InChI=1S/C13H23N5S/c1-9-7-18(8-10(2)14-9)13-15-12(16-17-13)11-5-3-4-6-19-11/h9-11,14H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | UMBTURBDWNAVOC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |