C28H30ClN3O5 — CID 10279791
ethyl (E,4R)-4-[[(2S)-2-[2-[5-(2-chlorophenyl)-1H-pyrrol-2-yl]-2-oxoethyl]pent-4-ynoyl]amino]-5-[(3R)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 10279791) has the molecular formula C28H30ClN3O5 and a molecular weight of 524.02 g/mol. Its IUPAC name is ethyl (E,4R)-4-[[(2S)-2-[2-[5-(2-chlorophenyl)-1H-pyrrol-2-yl]-2-oxoethyl]pent-4-ynoyl]amino]-5-[(3R)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[[(2S)-2-[2-[5-(2-chlorophenyl)-1H-pyrrol-2-yl]-2-oxoethyl]pent-4-ynoyl]amino]-5-[(3R)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 10279791 |
| Molecular Formula | C28H30ClN3O5 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | ethyl (E,4R)-4-[[(2S)-2-[2-[5-(2-chlorophenyl)-1H-pyrrol-2-yl]-2-oxoethyl]pent-4-ynoyl]amino]-5-[(3R)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | C#CC[C@@H](CC(=O)c1ccc(-c2ccccc2Cl)[nH]1)C(=O)N[C@@H](/C=C/C(=O)OCC)C[C@H]1CCNC1=O |
| InChI | InChI=1S/C28H30ClN3O5/c1-3-7-18(17-25(33)24-12-11-23(32-24)21-8-5-6-9-22(21)29)28(36)31-20(10-13-26(34)37-4-2)16-19-14-15-30-27(19)35/h1,5-6,8-13,18-20,32H,4,7,14-17H2,2H3,(H,30,35)(H,31,36)/b13-10+/t18-,19+,20-/m0/s1 |
| InChIKey | PYFQGARBMXDCRY-FRMPJASGSA-N |
| XLogP | 3.68 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|