C27H28F3N3O5 — CID 59086144
ethyl (E,4S)-7-amino-7-oxo-4-[[(2R)-2-[2-oxo-2-[5-[2-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]ethyl]pent-4-ynoyl]amino]hept-2-enoate (PubChem CID 59086144) has the molecular formula C27H28F3N3O5 and a molecular weight of 531.53 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-7-oxo-4-[[(2R)-2-[2-oxo-2-[5-[2-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]ethyl]pent-4-ynoyl]amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(2R)-2-[2-oxo-2-[5-[2-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]ethyl]pent-4-ynoyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 59086144 |
| Molecular Formula | C27H28F3N3O5 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(2R)-2-[2-oxo-2-[5-[2-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]ethyl]pent-4-ynoyl]amino]hept-2-enoate |
| SMILES | C#CC[C@H](CC(=O)c1ccc(-c2ccccc2C(F)(F)F)[nH]1)C(=O)N[C@H](/C=C/C(=O)OCC)CCC(N)=O |
| InChI | InChI=1S/C27H28F3N3O5/c1-3-7-17(26(37)32-18(10-14-24(31)35)11-15-25(36)38-4-2)16-23(34)22-13-12-21(33-22)19-8-5-6-9-20(19)27(28,29)30/h1,5-6,8-9,11-13,15,17-18,33H,4,7,10,14,16H2,2H3,(H2,31,35)(H,32,37)/b15-11+/t17-,18+/m1/s1 |
| InChIKey | XLAAMNXCVGUONG-CJOJLPBESA-N |
| XLogP | 3.78 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|