C30H34N4O6 — CID 20769097
ethyl (E)-7-amino-4-[[2-[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 20769097) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is ethyl (E)-7-amino-4-[[2-[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E)-7-amino-4-[[2-[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 20769097 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | ethyl (E)-7-amino-4-[[2-[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CCC(N)=O)NC(=O)C(Cc1ccccc1)NC(=O)c1ccc(-c2ccccc2OC)[nH]1 |
| InChI | InChI=1S/C30H34N4O6/c1-3-40-28(36)18-14-21(13-17-27(31)35)32-30(38)25(19-20-9-5-4-6-10-20)34-29(37)24-16-15-23(33-24)22-11-7-8-12-26(22)39-2/h4-12,14-16,18,21,25,33H,3,13,17,19H2,1-2H3,(H2,31,35)(H,32,38)(H,34,37)/b18-14+ |
| InChIKey | HOWRZROVSNSLDY-NBVRZTHBSA-N |
| XLogP | 2.90 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|