C26H27FN4O6 — CID 73458468
7-amino-4-[[3-(4-fluorophenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-7-oxohept-2-enoic acid (PubChem CID 73458468) has the molecular formula C26H27FN4O6 and a molecular weight of 510.52 g/mol. Its IUPAC name is 7-amino-4-[[3-(4-fluorophenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-7-oxohept-2-enoic acid.
| Compound Name | 7-amino-4-[[3-(4-fluorophenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-7-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 73458468 |
| Molecular Formula | C26H27FN4O6 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 7-amino-4-[[3-(4-fluorophenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-7-oxohept-2-enoic acid |
| SMILES | COc1cccc2[nH]c(C(=O)NC(Cc3ccc(F)cc3)C(=O)NC(C=CC(=O)O)CCC(N)=O)cc12 |
| InChI | InChI=1S/C26H27FN4O6/c1-37-22-4-2-3-19-18(22)14-21(30-19)26(36)31-20(13-15-5-7-16(27)8-6-15)25(35)29-17(9-11-23(28)32)10-12-24(33)34/h2-8,10,12,14,17,20,30H,9,11,13H2,1H3,(H2,28,32)(H,29,35)(H,31,36)(H,33,34) |
| InChIKey | AKYZWAGIOBSDGC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|