C25H33N5O7 — CID 167473261
ethyl (E)-4-[(3-amino-3-oxopropyl)-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]amino]-4-oxobut-2-enoate (PubChem CID 167473261) has the molecular formula C25H33N5O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is ethyl (E)-4-[(3-amino-3-oxopropyl)-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[(3-amino-3-oxopropyl)-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 167473261 |
| Molecular Formula | C25H33N5O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | ethyl (E)-4-[(3-amino-3-oxopropyl)-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)N(CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)c1cc2c(OC)cccc2[nH]1 |
| InChI | InChI=1S/C25H33N5O7/c1-5-37-23(33)10-9-22(32)30(12-11-21(26)31)29-25(35)18(13-15(2)3)28-24(34)19-14-16-17(27-19)7-6-8-20(16)36-4/h6-10,14-15,18,27H,5,11-13H2,1-4H3,(H2,26,31)(H,28,34)(H,29,35)/b10-9+/t18-/m0/s1 |
| InChIKey | SHWKBPUTNURLLW-BBVFFXRHSA-N |
| XLogP | 1.18 |
| TPSA | 172.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|