C28H33N3O5 — CID 18711724
ethyl (E)-4-[[3-(3,4-dimethylphenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]pent-2-enoate (PubChem CID 18711724) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is ethyl (E)-4-[[3-(3,4-dimethylphenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]pent-2-enoate.
| Compound Name | ethyl (E)-4-[[3-(3,4-dimethylphenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 18711724 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | ethyl (E)-4-[[3-(3,4-dimethylphenyl)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C)NC(=O)C(Cc1ccc(C)c(C)c1)NC(=O)c1cc2c(OC)cccc2[nH]1 |
| InChI | InChI=1S/C28H33N3O5/c1-6-36-26(32)13-11-19(4)29-27(33)23(15-20-12-10-17(2)18(3)14-20)31-28(34)24-16-21-22(30-24)8-7-9-25(21)35-5/h7-14,16,19,23,30H,6,15H2,1-5H3,(H,29,33)(H,31,34)/b13-11+ |
| InChIKey | JYGKTRGYUSENRL-ACCUITESSA-N |
| XLogP | 3.76 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|