C25H37N5O6 — CID 143239747
N-methoxy-2-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-N,N',N'-trimethylpentanediamide (PubChem CID 143239747) has the molecular formula C25H37N5O6 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-methoxy-2-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-N,N',N'-trimethylpentanediamide.
| Compound Name | N-methoxy-2-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-N,N',N'-trimethylpentanediamide |
|---|---|
| PubChem CID | 143239747 |
| Molecular Formula | C25H37N5O6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | N-methoxy-2-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-N,N',N'-trimethylpentanediamide |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC(C)C)C(=O)NC(CCC(=O)N(C)C)C(=O)N(C)OC)cc12 |
| InChI | InChI=1S/C25H37N5O6/c1-15(2)13-19(28-24(33)20-14-16-17(26-20)9-8-10-21(16)35-6)23(32)27-18(25(34)30(5)36-7)11-12-22(31)29(3)4/h8-10,14-15,18-19,26H,11-13H2,1-7H3,(H,27,32)(H,28,33)/t18?,19-/m0/s1 |
| InChIKey | SZYQVFFWGNDCED-GGYWPGCISA-N |
| XLogP | 1.69 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|