C33H34N4O5 — CID 10281349
ethyl (E,4R)-7-amino-4-[[(2R)-2-[(5-naphthalen-1-yl-1H-pyrrole-2-carbonyl)amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 10281349) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is ethyl (E,4R)-7-amino-4-[[(2R)-2-[(5-naphthalen-1-yl-1H-pyrrole-2-carbonyl)amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4R)-7-amino-4-[[(2R)-2-[(5-naphthalen-1-yl-1H-pyrrole-2-carbonyl)amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 10281349 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | ethyl (E,4R)-7-amino-4-[[(2R)-2-[(5-naphthalen-1-yl-1H-pyrrole-2-carbonyl)amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](CCC(N)=O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccc(-c2cccc3ccccc23)[nH]1 |
| InChI | InChI=1S/C33H34N4O5/c1-2-42-31(39)20-16-24(15-19-30(34)38)35-33(41)29(21-22-9-4-3-5-10-22)37-32(40)28-18-17-27(36-28)26-14-8-12-23-11-6-7-13-25(23)26/h3-14,16-18,20,24,29,36H,2,15,19,21H2,1H3,(H2,34,38)(H,35,41)(H,37,40)/b20-16+/t24-,29-/m1/s1 |
| InChIKey | UKNYBYUQWJDZHT-HAQGXXKLSA-N |
| XLogP | 4.05 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|