C30H34N4O6 — CID 91564177
ethyl (4S)-7-amino-4-[[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-(3-phenylpropanoyl)amino]-7-oxohept-2-enoate (PubChem CID 91564177) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is ethyl (4S)-7-amino-4-[[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-(3-phenylpropanoyl)amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (4S)-7-amino-4-[[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-(3-phenylpropanoyl)amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 91564177 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | ethyl (4S)-7-amino-4-[[[5-(2-methoxyphenyl)-1H-pyrrole-2-carbonyl]amino]-(3-phenylpropanoyl)amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)C=C[C@H](CCC(N)=O)N(NC(=O)c1ccc(-c2ccccc2OC)[nH]1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C30H34N4O6/c1-3-40-29(37)20-15-22(14-18-27(31)35)34(28(36)19-13-21-9-5-4-6-10-21)33-30(38)25-17-16-24(32-25)23-11-7-8-12-26(23)39-2/h4-12,15-17,20,22,32H,3,13-14,18-19H2,1-2H3,(H2,31,35)(H,33,38)/t22-/m0/s1 |
| InChIKey | UQCUAJWRXFCLGI-QFIPXVFZSA-N |
| XLogP | 3.55 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|