C24H26N2O5 — CID 102023904
ethyl (E,4S)-7-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxohept-2-enoate (PubChem CID 102023904) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 102023904 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-2-30-23(28)14-12-16(11-13-22(25)27)26-24(29)31-15-21-19-9-5-3-7-17(19)18-8-4-6-10-20(18)21/h3-10,12,14,16,21H,2,11,13,15H2,1H3,(H2,25,27)(H,26,29)/b14-12+/t16-/m0/s1 |
| InChIKey | OFJDYOBJHIBWGF-GRNBYLDVSA-N |
| XLogP | 3.28 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|