C26H28N2O9 — CID 154728911
5-[bis(ethoxycarbonyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (PubChem CID 154728911) has the molecular formula C26H28N2O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is 5-[bis(ethoxycarbonyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid.
| Compound Name | 5-[bis(ethoxycarbonyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 154728911 |
| Molecular Formula | C26H28N2O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 5-[bis(ethoxycarbonyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
| SMILES | CCOC(=O)N(C(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C26H28N2O9/c1-3-35-25(33)28(26(34)36-4-2)22(29)14-13-21(23(30)31)27-24(32)37-15-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-12,20-21H,3-4,13-15H2,1-2H3,(H,27,32)(H,30,31) |
| InChIKey | GKHZCPZPRZXHIU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|