C13H14F3N5 — CID 102798133
(3S)-3-methyl-1-[5-(3,4,5-trifluorophenyl)-1H-1,2,4-triazol-3-yl]piperazine (PubChem CID 102798133) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is (3S)-3-methyl-1-[5-(3,4,5-trifluorophenyl)-1H-1,2,4-triazol-3-yl]piperazine.
| Compound Name | (3S)-3-methyl-1-[5-(3,4,5-trifluorophenyl)-1H-1,2,4-triazol-3-yl]piperazine |
|---|---|
| PubChem CID | 102798133 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3S)-3-methyl-1-[5-(3,4,5-trifluorophenyl)-1H-1,2,4-triazol-3-yl]piperazine |
| SMILES | C[C@H]1CN(c2n[nH]c(-c3cc(F)c(F)c(F)c3)n2)CCN1 |
| InChI | InChI=1S/C13H14F3N5/c1-7-6-21(3-2-17-7)13-18-12(19-20-13)8-4-9(14)11(16)10(15)5-8/h4-5,7,17H,2-3,6H2,1H3,(H,18,19,20)/t7-/m0/s1 |
| InChIKey | KQZQGPGSCJLBOI-ZETCQYMHSA-N |
| XLogP | 1.69 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|