C13H15Cl2N5 — CID 102798340
1-[5-(3,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]-3-methylpiperazine (PubChem CID 102798340) has the molecular formula C13H15Cl2N5 and a molecular weight of 312.20 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]-3-methylpiperazine.
| Compound Name | 1-[5-(3,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]-3-methylpiperazine |
|---|---|
| PubChem CID | 102798340 |
| Molecular Formula | C13H15Cl2N5 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]-3-methylpiperazine |
| SMILES | CC1CN(c2n[nH]c(-c3ccc(Cl)c(Cl)c3)n2)CCN1 |
| InChI | InChI=1S/C13H15Cl2N5/c1-8-7-20(5-4-16-8)13-17-12(18-19-13)9-2-3-10(14)11(15)6-9/h2-3,6,8,16H,4-5,7H2,1H3,(H,17,18,19) |
| InChIKey | JAIRTNUIRYIYOF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |