C36H40N2O2 — CID 10280148
N-(1-benzylpiperidin-4-yl)-4-butoxy-N-[(4-phenylphenyl)methyl]benzamide (PubChem CID 10280148) has the molecular formula C36H40N2O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-butoxy-N-[(4-phenylphenyl)methyl]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-butoxy-N-[(4-phenylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10280148 |
| Molecular Formula | C36H40N2O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-butoxy-N-[(4-phenylphenyl)methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2ccc(-c3ccccc3)cc2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C36H40N2O2/c1-2-3-26-40-35-20-18-33(19-21-35)36(39)38(28-30-14-16-32(17-15-30)31-12-8-5-9-13-31)34-22-24-37(25-23-34)27-29-10-6-4-7-11-29/h4-21,34H,2-3,22-28H2,1H3 |
| InChIKey | KFXHIJXBEYHCQC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|