C33H36N2O3 — CID 10164424
2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide (PubChem CID 10164424) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10164424 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide |
| SMILES | COc1ccc(CN(CCCOc2cccc(CC(N)=O)c2)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N2O3/c1-37-30-18-16-26(17-19-30)24-35(20-9-21-38-31-15-8-10-27(22-31)23-33(34)36)25-32(28-11-4-2-5-12-28)29-13-6-3-7-14-29/h2-8,10-19,22,32H,9,20-21,23-25H2,1H3,(H2,34,36) |
| InChIKey | ZMEAEUNNMHQAJK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|