C33H33F3N2O2 — CID 10280681
2-[3-[3-[2,2-diphenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetamide (PubChem CID 10280681) has the molecular formula C33H33F3N2O2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10280681 |
| Molecular Formula | C33H33F3N2O2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H33F3N2O2/c34-33(35,36)29-16-7-11-26(20-29)23-38(18-9-19-40-30-17-8-10-25(21-30)22-32(37)39)24-31(27-12-3-1-4-13-27)28-14-5-2-6-15-28/h1-8,10-17,20-21,31H,9,18-19,22-24H2,(H2,37,39) |
| InChIKey | PVSVRPXIFWFGJY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|