C32H37F3N2O2 — CID 44532594
N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532594) has the molecular formula C32H37F3N2O2 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532594 |
| Molecular Formula | C32H37F3N2O2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1cc(C)ccc1C1CCN(CCCCNC(=O)c2cccc(-c3ccc(C(F)(F)F)cc3)c2)CC1 |
| InChI | InChI=1S/C32H37F3N2O2/c1-3-39-30-21-23(2)9-14-29(30)25-15-19-37(20-16-25)18-5-4-17-36-31(38)27-8-6-7-26(22-27)24-10-12-28(13-11-24)32(33,34)35/h6-14,21-22,25H,3-5,15-20H2,1-2H3,(H,36,38) |
| InChIKey | KFKJXQYCHOENDR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|