C33H35FN2O3 — CID 10301876
2-[3-[3-[2,2-diphenylethyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide (PubChem CID 10301876) has the molecular formula C33H35FN2O3 and a molecular weight of 526.65 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10301876 |
| Molecular Formula | C33H35FN2O3 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetamide |
| SMILES | COc1ccc(CN(CCCOc2cccc(CC(N)=O)c2)CC(c2ccccc2)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C33H35FN2O3/c1-38-29-17-16-28(32(34)22-29)23-36(18-9-19-39-30-15-8-10-25(20-30)21-33(35)37)24-31(26-11-4-2-5-12-26)27-13-6-3-7-14-27/h2-8,10-17,20,22,31H,9,18-19,21,23-24H2,1H3,(H2,35,37) |
| InChIKey | DIASBTZRVLJKDB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|