About 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid
2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid (PubChem CID 10301104) has the molecular formula C33H35NO4
and a molecular weight of 509.65 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid |
| PubChem CID | 10301104 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid |
| SMILES | COc1ccc(CN(CCCOc2cccc(CC(=O)O)c2)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H35NO4/c1-37-30-18-16-26(17-19-30)24-34(20-9-21-38-31-15-8-10-27(22-31)23-33(35)36)25-32(28-11-4-2-5-12-28)29-13-6-3-7-14-29/h2-8,10-19,22,32H,9,20-21,23-25H2,1H3,(H,35,36) |
| InChIKey | HSYNLNWVLYRQES-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid?
The IUPAC name of 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid (CID 10301104) is 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid is COc1ccc(CN(CCCOc2cccc(CC(=O)O)c2)CC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid?
The InChIKey is HSYNLNWVLYRQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H35NO4/c1-37-30-18-16-26(17-19-30)24-34(20-9-21-38-31-15-8-10-27(22-31)23-33(35)36)25-32(28-11-4-2-5-12-28)29-13-6-3-7-14-29/h2-8,10-19,22,32H,9,20-21,23-25H2,1H3,(H,35,36).
What are the key properties of 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid?
2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid has a molecular weight of 509.65 g/mol, XLogP of 6.43, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetic acid is sourced from PubChem (CID 10301104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).