C34H33ClF3NO3 — CID 10129169
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 10129169) has the molecular formula C34H33ClF3NO3 and a molecular weight of 596.09 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10129169 |
| Molecular Formula | C34H33ClF3NO3 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H33ClF3NO3/c1-24(33(40)41)27-15-8-17-29(21-27)42-20-10-19-39(22-28-16-9-18-31(32(28)35)34(36,37)38)23-30(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-9,11-18,21,24,30H,10,19-20,22-23H2,1H3,(H,40,41) |
| InChIKey | AVNLUJALSLNPNX-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|