C33H32ClF3NO3+ — CID 78224549
3-[3-(carboxymethyl)phenoxy]propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-(2,2-diphenylethyl)azanium (PubChem CID 78224549) has the molecular formula C33H32ClF3NO3+ and a molecular weight of 583.07 g/mol. Its IUPAC name is 3-[3-(carboxymethyl)phenoxy]propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-(2,2-diphenylethyl)azanium.
| Compound Name | 3-[3-(carboxymethyl)phenoxy]propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-(2,2-diphenylethyl)azanium |
|---|---|
| PubChem CID | 78224549 |
| Molecular Formula | C33H32ClF3NO3+ |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 3-[3-(carboxymethyl)phenoxy]propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-(2,2-diphenylethyl)azanium |
| SMILES | O=C(O)Cc1cccc(OCCC[NH+](Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H31ClF3NO3/c34-32-27(15-8-17-30(32)33(35,36)37)22-38(18-9-19-41-28-16-7-10-24(20-28)21-31(39)40)23-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-8,10-17,20,29H,9,18-19,21-23H2,(H,39,40)/p+1 |
| InChIKey | NAXSRXHZFIBFMI-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|