C8H12N6O — CID 102802240
N-(2-azidoethyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 102802240) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(2-azidoethyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2-azidoethyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102802240 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | N-(2-azidoethyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C8H12N6O/c1-6-7(5-14(2)12-6)8(15)10-3-4-11-13-9/h5H,3-4H2,1-2H3,(H,10,15) |
| InChIKey | JMXHQKOJUSLQKX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|